C12H27BO9 — CID 175400183
tris(1,2-dimethoxyethyl) borate (PubChem CID 175400183) has the molecular formula C12H27BO9 and a molecular weight of 326.15 g/mol. Its IUPAC name is tris(1,2-dimethoxyethyl) borate.
| Compound Name | tris(1,2-dimethoxyethyl) borate |
|---|---|
| PubChem CID | 175400183 |
| Molecular Formula | C12H27BO9 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 326.17 |
| IUPAC Name | tris(1,2-dimethoxyethyl) borate |
| SMILES | COCC(OC)OB(OC(COC)OC)OC(COC)OC |
| InChI | InChI=1S/C12H27BO9/c1-14-7-10(17-4)20-13(21-11(18-5)8-15-2)22-12(19-6)9-16-3/h10-12H,7-9H2,1-6H3 |
| InChIKey | XSAUIXLMTPBONO-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|