C5H9NO2 — CID 92976102
(2S)-2,3-dimethoxypropanenitrile (PubChem CID 92976102) has the molecular formula C5H9NO2 and a molecular weight of 115.13 g/mol. Its IUPAC name is (2S)-2,3-dimethoxypropanenitrile.
| Compound Name | (2S)-2,3-dimethoxypropanenitrile |
|---|---|
| PubChem CID | 92976102 |
| Molecular Formula | C5H9NO2 |
| Molecular Weight | 115.13 g/mol |
| Exact Mass | 115.06 |
| IUPAC Name | (2S)-2,3-dimethoxypropanenitrile |
| SMILES | COC[C@H](C#N)OC |
| InChI | InChI=1S/C5H9NO2/c1-7-4-5(3-6)8-2/h5H,4H2,1-2H3/t5-/m0/s1 |
| InChIKey | DFQDZETVYUYDGH-YFKPBYRVSA-N |
| XLogP | 0.17 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 115.13 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |