About (1-cyano-2-methoxyethyl) carbamate
(1-cyano-2-methoxyethyl) carbamate (PubChem CID 154928164) has the molecular formula C5H8N2O3
and a molecular weight of 144.13 g/mol. Its IUPAC name is (1-cyano-2-methoxyethyl) carbamate.
Molecular Properties
| Compound Name | (1-cyano-2-methoxyethyl) carbamate |
| PubChem CID | 154928164 |
| Molecular Formula | C5H8N2O3 |
| Molecular Weight | 144.13 g/mol |
| Exact Mass | 144.05 |
| IUPAC Name | (1-cyano-2-methoxyethyl) carbamate |
| SMILES | COCC(C#N)OC(N)=O |
| InChI | InChI=1S/C5H8N2O3/c1-9-3-4(2-6)10-5(7)8/h4H,3H2,1H3,(H2,7,8) |
| InChIKey | LWJWMHPVHULNML-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.13 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (1-cyano-2-methoxyethyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-cyano-2-methoxyethyl) carbamate?
The IUPAC name of (1-cyano-2-methoxyethyl) carbamate (CID 154928164) is (1-cyano-2-methoxyethyl) carbamate.
What is the SMILES notation for (1-cyano-2-methoxyethyl) carbamate?
The canonical SMILES for (1-cyano-2-methoxyethyl) carbamate is COCC(C#N)OC(N)=O.
What is the InChIKey of (1-cyano-2-methoxyethyl) carbamate?
The InChIKey is LWJWMHPVHULNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O3/c1-9-3-4(2-6)10-5(7)8/h4H,3H2,1H3,(H2,7,8).
What are the key properties of (1-cyano-2-methoxyethyl) carbamate?
(1-cyano-2-methoxyethyl) carbamate has a molecular weight of 144.13 g/mol, XLogP of -0.38, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (1-cyano-2-methoxyethyl) carbamate is sourced from PubChem (CID 154928164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).