About 1,2-dimethoxyethoxyurea
1,2-dimethoxyethoxyurea (PubChem CID 87600210) has the molecular formula C5H12N2O4
and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,2-dimethoxyethoxyurea.
Molecular Properties
| Compound Name | 1,2-dimethoxyethoxyurea |
| PubChem CID | 87600210 |
| Molecular Formula | C5H12N2O4 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1,2-dimethoxyethoxyurea |
| SMILES | COCC(OC)ONC(N)=O |
| InChI | InChI=1S/C5H12N2O4/c1-9-3-4(10-2)11-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8) |
| InChIKey | NGRPUANNXHEKCV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethoxyethoxyurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethoxyethoxyurea?
The IUPAC name of 1,2-dimethoxyethoxyurea (CID 87600210) is 1,2-dimethoxyethoxyurea.
What is the SMILES notation for 1,2-dimethoxyethoxyurea?
The canonical SMILES for 1,2-dimethoxyethoxyurea is COCC(OC)ONC(N)=O.
What is the InChIKey of 1,2-dimethoxyethoxyurea?
The InChIKey is NGRPUANNXHEKCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O4/c1-9-3-4(10-2)11-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8).
What are the key properties of 1,2-dimethoxyethoxyurea?
1,2-dimethoxyethoxyurea has a molecular weight of 164.16 g/mol, XLogP of -0.79, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethoxyethoxyurea is sourced from PubChem (CID 87600210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).