C5H12N2O4 — CID 87600210
1,2-dimethoxyethoxyurea (PubChem CID 87600210) has the molecular formula C5H12N2O4 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,2-dimethoxyethoxyurea.
| Compound Name | 1,2-dimethoxyethoxyurea |
|---|---|
| PubChem CID | 87600210 |
| Molecular Formula | C5H12N2O4 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 1,2-dimethoxyethoxyurea |
| SMILES | COCC(OC)ONC(N)=O |
| InChI | InChI=1S/C5H12N2O4/c1-9-3-4(10-2)11-7-5(6)8/h4H,3H2,1-2H3,(H3,6,7,8) |
| InChIKey | NGRPUANNXHEKCV-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 82.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|