C7H16O5 — CID 154193438
1-(dimethoxymethoxy)-1,2-dimethoxyethane (PubChem CID 154193438) has the molecular formula C7H16O5 and a molecular weight of 180.20 g/mol. Its IUPAC name is 1-(dimethoxymethoxy)-1,2-dimethoxyethane.
| Compound Name | 1-(dimethoxymethoxy)-1,2-dimethoxyethane |
|---|---|
| PubChem CID | 154193438 |
| Molecular Formula | C7H16O5 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | 1-(dimethoxymethoxy)-1,2-dimethoxyethane |
| SMILES | COCC(OC)OC(OC)OC |
| InChI | InChI=1S/C7H16O5/c1-8-5-6(9-2)12-7(10-3)11-4/h6-7H,5H2,1-4H3 |
| InChIKey | OLYDBMMIKQFNGY-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|