About 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid
3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid (PubChem CID 153427168) has the molecular formula C10H12O5
and a molecular weight of 212.20 g/mol. Its IUPAC name is 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid.
Molecular Properties
| Compound Name | 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid |
| PubChem CID | 153427168 |
| Molecular Formula | C10H12O5 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid |
| SMILES | O=C(O)CCc1ccc(O)c(O)c1CO |
| InChI | InChI=1S/C10H12O5/c11-5-7-6(2-4-9(13)14)1-3-8(12)10(7)15/h1,3,11-12,15H,2,4-5H2,(H,13,14) |
| InChIKey | ILUZSSXPOUMBTE-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|
Analyze 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid?
The IUPAC name of 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid (CID 153427168) is 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid.
What is the SMILES notation for 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid?
The canonical SMILES for 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid is O=C(O)CCc1ccc(O)c(O)c1CO.
What is the InChIKey of 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid?
The InChIKey is ILUZSSXPOUMBTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O5/c11-5-7-6(2-4-9(13)14)1-3-8(12)10(7)15/h1,3,11-12,15H,2,4-5H2,(H,13,14).
What are the key properties of 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid?
3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid has a molecular weight of 212.20 g/mol, XLogP of 0.61, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3,4-dihydroxy-2-(hydroxymethyl)phenyl]propanoic acid is sourced from PubChem (CID 153427168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).