C18H26O7 — CID 15342724
tert-butyl (1S,5R,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dioxo-2-oxabicyclo[3.3.1]nonane-5-carboxylate (PubChem CID 15342724) has the molecular formula C18H26O7 and a molecular weight of 354.40 g/mol. Its IUPAC name is tert-butyl (1S,5R,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dioxo-2-oxabicyclo[3.3.1]nonane-5-carboxylate.
| Compound Name | tert-butyl (1S,5R,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dioxo-2-oxabicyclo[3.3.1]nonane-5-carboxylate |
|---|---|
| PubChem CID | 15342724 |
| Molecular Formula | C18H26O7 |
| Molecular Weight | 354.40 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl (1S,5R,9S)-9-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dioxo-2-oxabicyclo[3.3.1]nonane-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)[C@@]12CC(=O)O[C@@H](CCC1=O)[C@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H26O7/c1-16(2,3)25-15(21)18-8-13(20)23-10(6-7-12(18)19)14(18)11-9-22-17(4,5)24-11/h10-11,14H,6-9H2,1-5H3/t10-,11+,14-,18-/m0/s1 |
| InChIKey | JMRKZXWYFWRKNQ-WZTYKQCMSA-N |
| XLogP | 1.76 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.40 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|