C25H38O6 — CID 139265273
methyl (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-3,10,12,14,16-pentamethyl-15,17-dioxo-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-4-carboxylate (PubChem CID 139265273) has the molecular formula C25H38O6 and a molecular weight of 434.57 g/mol. Its IUPAC name is methyl (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-3,10,12,14,16-pentamethyl-15,17-dioxo-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-4-carboxylate.
| Compound Name | methyl (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-3,10,12,14,16-pentamethyl-15,17-dioxo-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-4-carboxylate |
|---|---|
| PubChem CID | 139265273 |
| Molecular Formula | C25H38O6 |
| Molecular Weight | 434.57 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | methyl (1S,3S,4S,6S,10R,12R,13R,14S,16R,19R)-3,10,12,14,16-pentamethyl-15,17-dioxo-18,20-dioxatetracyclo[11.5.2.01,6.016,19]icosane-4-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@H]2CCC[C@@H](C)C[C@@H](C)[C@H]3O[C@@H]4[C@@](C)(C(=O)O[C@@]24C[C@@H]1C)C(=O)[C@H]3C |
| InChI | InChI=1S/C25H38O6/c1-13-8-7-9-17-11-18(21(27)29-6)15(3)12-25(17)22-24(5,23(28)31-25)20(26)16(4)19(30-22)14(2)10-13/h13-19,22H,7-12H2,1-6H3/t13-,14-,15+,16+,17+,18+,19-,22-,24+,25+/m1/s1 |
| InChIKey | CQGUZMLHIMAYNT-HWNWOGDVSA-N |
| XLogP | 3.94 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|