C24H24F3N5O3S — CID 153427257
4-[[6-(2,4,5-trifluoroanilino)-2-pyridinyl]sulfonyl]-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide (PubChem CID 153427257) has the molecular formula C24H24F3N5O3S and a molecular weight of 519.55 g/mol. Its IUPAC name is 4-[[6-(2,4,5-trifluoroanilino)-2-pyridinyl]sulfonyl]-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide.
| Compound Name | 4-[[6-(2,4,5-trifluoroanilino)-2-pyridinyl]sulfonyl]-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 153427257 |
| Molecular Formula | C24H24F3N5O3S |
| Molecular Weight | 519.55 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 4-[[6-(2,4,5-trifluoroanilino)-2-pyridinyl]sulfonyl]-2-(2,2,4-trimethylpyrrolidin-1-yl)pyridine-3-carboxamide |
| SMILES | CC1CN(c2nccc(S(=O)(=O)c3cccc(Nc4cc(F)c(F)cc4F)n3)c2C(N)=O)C(C)(C)C1 |
| InChI | InChI=1S/C24H24F3N5O3S/c1-13-11-24(2,3)32(12-13)23-21(22(28)33)18(7-8-29-23)36(34,35)20-6-4-5-19(31-20)30-17-10-15(26)14(25)9-16(17)27/h4-10,13H,11-12H2,1-3H3,(H2,28,33)(H,30,31) |
| InChIKey | WXWYLIXVSQDXLR-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.55 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|