C34H26N2OPt — CID 153428737
4-tert-butyl-2-[3-[(3-pyridin-2-yl-2H-naphthalen-2-id-1-yl)oxy]-2H-naphthalen-2-id-1-yl]pyridine;platinum(2+) (PubChem CID 153428737) has the molecular formula C34H26N2OPt and a molecular weight of 673.67 g/mol. Its IUPAC name is 4-tert-butyl-2-[3-[(3-pyridin-2-yl-2H-naphthalen-2-id-1-yl)oxy]-2H-naphthalen-2-id-1-yl]pyridine;platinum(2+).
| Compound Name | 4-tert-butyl-2-[3-[(3-pyridin-2-yl-2H-naphthalen-2-id-1-yl)oxy]-2H-naphthalen-2-id-1-yl]pyridine;platinum(2+) |
|---|---|
| PubChem CID | 153428737 |
| Molecular Formula | C34H26N2OPt |
| Molecular Weight | 673.67 g/mol |
| Exact Mass | 673.17 |
| IUPAC Name | 4-tert-butyl-2-[3-[(3-pyridin-2-yl-2H-naphthalen-2-id-1-yl)oxy]-2H-naphthalen-2-id-1-yl]pyridine;platinum(2+) |
| SMILES | CC(C)(C)c1ccnc(-c2[c-]c(Oc3[c-]c(-c4ccccn4)cc4ccccc34)cc3ccccc23)c1.[Pt+2] |
| InChI | InChI=1S/C34H26N2O.Pt/c1-34(2,3)26-15-17-36-32(21-26)30-22-27(19-24-11-4-6-12-28(24)30)37-33-20-25(31-14-8-9-16-35-31)18-23-10-5-7-13-29(23)33;/h4-19,21H,1-3H3;/q-2;+2 |
| InChIKey | YWZSCYXSLZYGIN-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.67 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|