C12H8N4 — CID 15343013
5-methylpyridazino[4,5-b]indole-4-carbonitrile (PubChem CID 15343013) has the molecular formula C12H8N4 and a molecular weight of 208.22 g/mol. Its IUPAC name is 5-methylpyridazino[4,5-b]indole-4-carbonitrile.
| Compound Name | 5-methylpyridazino[4,5-b]indole-4-carbonitrile |
|---|---|
| PubChem CID | 15343013 |
| Molecular Formula | C12H8N4 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | 5-methylpyridazino[4,5-b]indole-4-carbonitrile |
| SMILES | Cn1c2ccccc2c2cnnc(C#N)c21 |
| InChI | InChI=1S/C12H8N4/c1-16-11-5-3-2-4-8(11)9-7-14-15-10(6-13)12(9)16/h2-5,7H,1H3 |
| InChIKey | PMNJWSTUOHAJRU-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |