C22H24N2O8S — CID 153430863
methyl 2-[1-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate (PubChem CID 153430863) has the molecular formula C22H24N2O8S and a molecular weight of 476.51 g/mol. Its IUPAC name is methyl 2-[1-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate.
| Compound Name | methyl 2-[1-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 153430863 |
| Molecular Formula | C22H24N2O8S |
| Molecular Weight | 476.51 g/mol |
| Exact Mass | 476.13 |
| IUPAC Name | methyl 2-[1-[[2-[2-(2-methoxyethoxy)ethoxy]acetyl]oxymethyl]indole-3-carbonyl]-1,3-thiazole-4-carboxylate |
| SMILES | COCCOCCOCC(=O)OCn1cc(C(=O)c2nc(C(=O)OC)cs2)c2ccccc21 |
| InChI | InChI=1S/C22H24N2O8S/c1-28-7-8-30-9-10-31-12-19(25)32-14-24-11-16(15-5-3-4-6-18(15)24)20(26)21-23-17(13-33-21)22(27)29-2/h3-6,11,13H,7-10,12,14H2,1-2H3 |
| InChIKey | BXVHWIVDADTANE-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 115.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.51 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|