C31H43O4P — CID 153431509
1,9-dicyclohexyl-11-hydroxy-3,7-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide (PubChem CID 153431509) has the molecular formula C31H43O4P and a molecular weight of 510.66 g/mol. Its IUPAC name is 1,9-dicyclohexyl-11-hydroxy-3,7-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide.
| Compound Name | 1,9-dicyclohexyl-11-hydroxy-3,7-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
|---|---|
| PubChem CID | 153431509 |
| Molecular Formula | C31H43O4P |
| Molecular Weight | 510.66 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 1,9-dicyclohexyl-11-hydroxy-3,7-di(propan-2-yl)-5H-benzo[d][1,3,2]benzodioxaphosphocine 11-oxide |
| SMILES | CC(C)c1cc2c(c(C3CCCCC3)c1)OP(=O)(O)Oc1c(cc(C(C)C)cc1C1CCCCC1)C2 |
| InChI | InChI=1S/C31H43O4P/c1-20(2)24-15-26-17-27-16-25(21(3)4)19-29(23-13-9-6-10-14-23)31(27)35-36(32,33)34-30(26)28(18-24)22-11-7-5-8-12-22/h15-16,18-23H,5-14,17H2,1-4H3,(H,32,33) |
| InChIKey | FELILAYLQFTBEO-UHFFFAOYSA-N |
| XLogP | 9.49 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.66 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|