C28H28O4 — CID 141300261
2-[2-(2-carboxyphenyl)-3-cyclopentyl-5-propan-2-ylphenyl]benzoic acid (PubChem CID 141300261) has the molecular formula C28H28O4 and a molecular weight of 428.53 g/mol. Its IUPAC name is 2-[2-(2-carboxyphenyl)-3-cyclopentyl-5-propan-2-ylphenyl]benzoic acid.
| Compound Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-5-propan-2-ylphenyl]benzoic acid |
|---|---|
| PubChem CID | 141300261 |
| Molecular Formula | C28H28O4 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-5-propan-2-ylphenyl]benzoic acid |
| SMILES | CC(C)c1cc(-c2ccccc2C(=O)O)c(-c2ccccc2C(=O)O)c(C2CCCC2)c1 |
| InChI | InChI=1S/C28H28O4/c1-17(2)19-15-24(18-9-3-4-10-18)26(21-12-6-8-14-23(21)28(31)32)25(16-19)20-11-5-7-13-22(20)27(29)30/h5-8,11-18H,3-4,9-10H2,1-2H3,(H,29,30)(H,31,32) |
| InChIKey | UOVOSGCNOWQMNP-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |