C31H26O4 — CID 151948062
2-[2-(2-carboxyphenyl)-6-cyclopentyl-3-phenylphenyl]benzoic acid (PubChem CID 151948062) has the molecular formula C31H26O4 and a molecular weight of 462.55 g/mol. Its IUPAC name is 2-[2-(2-carboxyphenyl)-6-cyclopentyl-3-phenylphenyl]benzoic acid.
| Compound Name | 2-[2-(2-carboxyphenyl)-6-cyclopentyl-3-phenylphenyl]benzoic acid |
|---|---|
| PubChem CID | 151948062 |
| Molecular Formula | C31H26O4 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 2-[2-(2-carboxyphenyl)-6-cyclopentyl-3-phenylphenyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1-c1c(-c2ccccc2)ccc(C2CCCC2)c1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C31H26O4/c32-30(33)26-16-8-6-14-24(26)28-22(20-10-2-1-3-11-20)18-19-23(21-12-4-5-13-21)29(28)25-15-7-9-17-27(25)31(34)35/h1-3,6-11,14-19,21H,4-5,12-13H2,(H,32,33)(H,34,35) |
| InChIKey | TWBBSCXMEHFFSX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |