C31H34O4 — CID 151307138
2-[2-(2-carboxyphenyl)-3-cyclopentyl-4,6-dipropylphenyl]benzoic acid (PubChem CID 151307138) has the molecular formula C31H34O4 and a molecular weight of 470.61 g/mol. Its IUPAC name is 2-[2-(2-carboxyphenyl)-3-cyclopentyl-4,6-dipropylphenyl]benzoic acid.
| Compound Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-4,6-dipropylphenyl]benzoic acid |
|---|---|
| PubChem CID | 151307138 |
| Molecular Formula | C31H34O4 |
| Molecular Weight | 470.61 g/mol |
| Exact Mass | 470.25 |
| IUPAC Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-4,6-dipropylphenyl]benzoic acid |
| SMILES | CCCc1cc(CCC)c(C2CCCC2)c(-c2ccccc2C(=O)O)c1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C31H34O4/c1-3-11-21-19-22(12-4-2)28(23-15-7-9-17-25(23)30(32)33)29(27(21)20-13-5-6-14-20)24-16-8-10-18-26(24)31(34)35/h7-10,15-20H,3-6,11-14H2,1-2H3,(H,32,33)(H,34,35) |
| InChIKey | ODQQLSUXEQMDLL-UHFFFAOYSA-N |
| XLogP | 7.98 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.61 |
| LogP ≤ 5 | 7.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |