C29H30O4 — CID 151165106
2-[2-(2-carboxyphenyl)-3-cyclopentyl-6-methyl-4-propylphenyl]benzoic acid (PubChem CID 151165106) has the molecular formula C29H30O4 and a molecular weight of 442.56 g/mol. Its IUPAC name is 2-[2-(2-carboxyphenyl)-3-cyclopentyl-6-methyl-4-propylphenyl]benzoic acid.
| Compound Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-6-methyl-4-propylphenyl]benzoic acid |
|---|---|
| PubChem CID | 151165106 |
| Molecular Formula | C29H30O4 |
| Molecular Weight | 442.56 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 2-[2-(2-carboxyphenyl)-3-cyclopentyl-6-methyl-4-propylphenyl]benzoic acid |
| SMILES | CCCc1cc(C)c(-c2ccccc2C(=O)O)c(-c2ccccc2C(=O)O)c1C1CCCC1 |
| InChI | InChI=1S/C29H30O4/c1-3-10-20-17-18(2)25(21-13-6-8-15-23(21)28(30)31)27(26(20)19-11-4-5-12-19)22-14-7-9-16-24(22)29(32)33/h6-9,13-17,19H,3-5,10-12H2,1-2H3,(H,30,31)(H,32,33) |
| InChIKey | NBBUCLIGQRJDRJ-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.56 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |