C30H34O4 — CID 152612531
2-[3-butyl-2-(2-carboxyphenyl)-4,6-dipropylphenyl]benzoic acid (PubChem CID 152612531) has the molecular formula C30H34O4 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[3-butyl-2-(2-carboxyphenyl)-4,6-dipropylphenyl]benzoic acid.
| Compound Name | 2-[3-butyl-2-(2-carboxyphenyl)-4,6-dipropylphenyl]benzoic acid |
|---|---|
| PubChem CID | 152612531 |
| Molecular Formula | C30H34O4 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.25 |
| IUPAC Name | 2-[3-butyl-2-(2-carboxyphenyl)-4,6-dipropylphenyl]benzoic acid |
| SMILES | CCCCc1c(CCC)cc(CCC)c(-c2ccccc2C(=O)O)c1-c1ccccc1C(=O)O |
| InChI | InChI=1S/C30H34O4/c1-4-7-14-22-20(12-5-2)19-21(13-6-3)27(23-15-8-10-17-25(23)29(31)32)28(22)24-16-9-11-18-26(24)30(33)34/h8-11,15-19H,4-7,12-14H2,1-3H3,(H,31,32)(H,33,34) |
| InChIKey | YZVDKQUTZIVGMH-UHFFFAOYSA-N |
| XLogP | 7.66 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |