C70H40N6S2 — CID 153432335
5-[2-[4-([1]benzothiolo[3,2-c]carbazol-5-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4-isocyanophenyl)phenyl]-[1]benzothiolo[3,2-c]carbazole (PubChem CID 153432335) has the molecular formula C70H40N6S2 and a molecular weight of 1029.27 g/mol. Its IUPAC name is 5-[2-[4-([1]benzothiolo[3,2-c]carbazol-5-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4-isocyanophenyl)phenyl]-[1]benzothiolo[3,2-c]carbazole.
| Compound Name | 5-[2-[4-([1]benzothiolo[3,2-c]carbazol-5-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4-isocyanophenyl)phenyl]-[1]benzothiolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 153432335 |
| Molecular Formula | C70H40N6S2 |
| Molecular Weight | 1029.27 g/mol |
| Exact Mass | 1028.28 |
| IUPAC Name | 5-[2-[4-([1]benzothiolo[3,2-c]carbazol-5-yl)-3-(4,6-diphenyl-1,3,5-triazin-2-yl)phenyl]-4-(4-isocyanophenyl)phenyl]-[1]benzothiolo[3,2-c]carbazole |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-n3c4ccccc4c4c5sc6ccccc6c5ccc43)c(-c3ccc(-n4c5ccccc5c5c6sc7ccccc7c6ccc54)c(-c4nc(-c5ccccc5)nc(-c5ccccc5)n4)c3)c2)cc1 |
| InChI | InChI=1S/C70H40N6S2/c1-71-47-32-28-42(29-33-47)45-30-36-58(75-56-24-12-8-22-52(56)64-60(75)38-34-50-48-20-10-14-26-62(48)77-66(50)64)54(40-45)46-31-37-59(55(41-46)70-73-68(43-16-4-2-5-17-43)72-69(74-70)44-18-6-3-7-19-44)76-57-25-13-9-23-53(57)65-61(76)39-35-51-49-21-11-15-27-63(49)78-67(51)65/h2-41H |
| InChIKey | QEASVYFMHFEGIM-UHFFFAOYSA-N |
| XLogP | 19.69 |
| TPSA | 52.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1029.27 |
| LogP ≤ 5 | 19.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|