C52H31N5S — CID 172500455
9-[2-[4-[3-(7-isocyanodibenzothiophen-4-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-phenylphenyl]carbazole (PubChem CID 172500455) has the molecular formula C52H31N5S and a molecular weight of 757.92 g/mol. Its IUPAC name is 9-[2-[4-[3-(7-isocyanodibenzothiophen-4-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-phenylphenyl]carbazole.
| Compound Name | 9-[2-[4-[3-(7-isocyanodibenzothiophen-4-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-phenylphenyl]carbazole |
|---|---|
| PubChem CID | 172500455 |
| Molecular Formula | C52H31N5S |
| Molecular Weight | 757.92 g/mol |
| Exact Mass | 757.23 |
| IUPAC Name | 9-[2-[4-[3-(7-isocyanodibenzothiophen-4-yl)phenyl]-6-phenyl-1,3,5-triazin-2-yl]-5-phenylphenyl]carbazole |
| SMILES | [C-]#[N+]c1ccc2c(c1)sc1c(-c3cccc(-c4nc(-c5ccccc5)nc(-c5ccc(-c6ccccc6)cc5-n5c6ccccc6c6ccccc65)n4)c3)cccc12 |
| InChI | InChI=1S/C52H31N5S/c1-53-38-27-29-42-43-23-13-22-39(49(43)58-48(42)32-38)36-18-12-19-37(30-36)51-54-50(34-16-6-3-7-17-34)55-52(56-51)44-28-26-35(33-14-4-2-5-15-33)31-47(44)57-45-24-10-8-20-40(45)41-21-9-11-25-46(41)57/h2-32H |
| InChIKey | WKZNUIQJLOCDEC-UHFFFAOYSA-N |
| XLogP | 14.22 |
| TPSA | 47.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 757.92 |
| LogP ≤ 5 | 14.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|