C49H29N7S — CID 158055737
2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine (PubChem CID 158055737) has the molecular formula C49H29N7S and a molecular weight of 747.89 g/mol. Its IUPAC name is 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine.
| Compound Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
|---|---|
| PubChem CID | 158055737 |
| Molecular Formula | C49H29N7S |
| Molecular Weight | 747.89 g/mol |
| Exact Mass | 747.22 |
| IUPAC Name | 2-[7-(4,6-diphenyl-1,3,5-triazin-2-yl)dibenzothiophen-4-yl]-4-[4-(4-isocyanophenyl)phenyl]-6-phenyl-1,3,5-triazine |
| SMILES | [C-]#[N+]c1ccc(-c2ccc(-c3nc(-c4ccccc4)nc(-c4cccc5c4sc4cc(-c6nc(-c7ccccc7)nc(-c7ccccc7)n6)ccc45)n3)cc2)cc1 |
| InChI | InChI=1S/C49H29N7S/c1-50-38-27-24-32(25-28-38)31-20-22-36(23-21-31)47-52-46(35-16-9-4-10-17-35)55-49(56-47)41-19-11-18-40-39-29-26-37(30-42(39)57-43(40)41)48-53-44(33-12-5-2-6-13-33)51-45(54-48)34-14-7-3-8-15-34/h2-30H |
| InChIKey | JJDVYTOQZZDYOG-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 81.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 747.89 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|