C30H19N — CID 153432794
25-(2,3,4,5,6-pentadeuteriophenyl)-25-azahexacyclo[12.11.0.02,7.08,13.015,24.017,22]pentacosa-1(14),2,4,6,8,10,12,15,17,19,21,23-dodecaene (PubChem CID 153432794) has the molecular formula C30H19N and a molecular weight of 398.52 g/mol. Its IUPAC name is 25-(2,3,4,5,6-pentadeuteriophenyl)-25-azahexacyclo[12.11.0.02,7.08,13.015,24.017,22]pentacosa-1(14),2,4,6,8,10,12,15,17,19,21,23-dodecaene.
| Compound Name | 25-(2,3,4,5,6-pentadeuteriophenyl)-25-azahexacyclo[12.11.0.02,7.08,13.015,24.017,22]pentacosa-1(14),2,4,6,8,10,12,15,17,19,21,23-dodecaene |
|---|---|
| PubChem CID | 153432794 |
| Molecular Formula | C30H19N |
| Molecular Weight | 398.52 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 25-(2,3,4,5,6-pentadeuteriophenyl)-25-azahexacyclo[12.11.0.02,7.08,13.015,24.017,22]pentacosa-1(14),2,4,6,8,10,12,15,17,19,21,23-dodecaene |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3cc4ccccc4cc3c3c4ccccc4c4ccccc4c32)c([2H])c1[2H] |
| InChI | InChI=1S/C30H19N/c1-2-12-22(13-3-1)31-28-19-21-11-5-4-10-20(21)18-27(28)29-25-16-8-6-14-23(25)24-15-7-9-17-26(24)30(29)31/h1-19H/i1D,2D,3D,12D,13D |
| InChIKey | NADGBAAFGPFNKL-AYAICNHJSA-N |
| XLogP | 8.24 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.52 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|