C48H31N3 — CID 171414552
2-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]-5,12-diphenylindolo[3,2-c]carbazole (PubChem CID 171414552) has the molecular formula C48H31N3 and a molecular weight of 654.83 g/mol. Its IUPAC name is 2-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]-5,12-diphenylindolo[3,2-c]carbazole.
| Compound Name | 2-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]-5,12-diphenylindolo[3,2-c]carbazole |
|---|---|
| PubChem CID | 171414552 |
| Molecular Formula | C48H31N3 |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.28 |
| IUPAC Name | 2-[9-(2,3,4,5,6-pentadeuteriophenyl)carbazol-3-yl]-5,12-diphenylindolo[3,2-c]carbazole |
| SMILES | [2H]c1c([2H])c([2H])c(-n2c3ccccc3c3cc(-c4ccc5c(c4)c4c(ccc6c7ccccc7n(-c7ccccc7)c64)n5-c4ccccc4)ccc32)c([2H])c1[2H] |
| InChI | InChI=1S/C48H31N3/c1-4-14-34(15-5-1)49-42-22-12-11-21-38(42)40-30-32(24-27-44(40)49)33-25-28-45-41(31-33)47-46(50(45)35-16-6-2-7-17-35)29-26-39-37-20-10-13-23-43(37)51(48(39)47)36-18-8-3-9-19-36/h1-31H/i1D,4D,5D,14D,15D |
| InChIKey | VLJKYGLYGCMTLH-KMIUACPRSA-N |
| XLogP | 12.64 |
| TPSA | 14.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |