C27H18N4 — CID 153432833
4-(4-carbazol-9-yl-2,6-dimethylphenyl)-5-isocyanopyridine-3-carbonitrile (PubChem CID 153432833) has the molecular formula C27H18N4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-(4-carbazol-9-yl-2,6-dimethylphenyl)-5-isocyanopyridine-3-carbonitrile.
| Compound Name | 4-(4-carbazol-9-yl-2,6-dimethylphenyl)-5-isocyanopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 153432833 |
| Molecular Formula | C27H18N4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 4-(4-carbazol-9-yl-2,6-dimethylphenyl)-5-isocyanopyridine-3-carbonitrile |
| SMILES | [C-]#[N+]c1cncc(C#N)c1-c1c(C)cc(-n2c3ccccc3c3ccccc32)cc1C |
| InChI | InChI=1S/C27H18N4/c1-17-12-20(13-18(2)26(17)27-19(14-28)15-30-16-23(27)29-3)31-24-10-6-4-8-21(24)22-9-5-7-11-25(22)31/h4-13,15-16H,1-2H3 |
| InChIKey | FHNWDTYUVKDMCH-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 45.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|