C62H44IrN2OS-2 — CID 153432909
3-(9,9-diphenyl-3H-xanthen-3-id-4-yl)-9,9-dimethyl-8,8a-dihydroindeno[2,1-c]pyridine;iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine (PubChem CID 153432909) has the molecular formula C62H44IrN2OS-2 and a molecular weight of 1057.33 g/mol. Its IUPAC name is 3-(9,9-diphenyl-3H-xanthen-3-id-4-yl)-9,9-dimethyl-8,8a-dihydroindeno[2,1-c]pyridine;iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine.
| Compound Name | 3-(9,9-diphenyl-3H-xanthen-3-id-4-yl)-9,9-dimethyl-8,8a-dihydroindeno[2,1-c]pyridine;iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine |
|---|---|
| PubChem CID | 153432909 |
| Molecular Formula | C62H44IrN2OS-2 |
| Molecular Weight | 1057.33 g/mol |
| Exact Mass | 1057.28 |
| IUPAC Name | 3-(9,9-diphenyl-3H-xanthen-3-id-4-yl)-9,9-dimethyl-8,8a-dihydroindeno[2,1-c]pyridine;iridium;2-(8-phenyl-3H-dibenzothiophen-3-id-4-yl)pyridine |
| SMILES | CC1(C)c2cnc(-c3[c-]ccc4c3Oc3ccccc3C4(c3ccccc3)c3ccccc3)cc2C2=CC=CCC21.[Ir].[c-]1ccc2c(sc3ccc(-c4ccccc4)cc32)c1-c1ccccn1 |
| InChI | InChI=1S/C39H30NO.C23H14NS.Ir/c1-38(2)31-20-10-9-18-28(31)30-24-35(40-25-34(30)38)29-19-13-22-33-37(29)41-36-23-12-11-21-32(36)39(33,26-14-5-3-6-15-26)27-16-7-4-8-17-27;1-2-7-16(8-3-1)17-12-13-22-20(15-17)18-9-6-10-19(23(18)25-22)21-11-4-5-14-24-21;/h3-18,21-25,31H,20H2,1-2H3;1-9,11-15H;/q2*-1; |
| InChIKey | NEKOSBHBOJJLID-UHFFFAOYSA-N |
| XLogP | 15.87 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1057.33 |
| LogP ≤ 5 | 15.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|