C65H74IrNO2S- — CID 58915734
2-[3-[7-[3,5-bis(4-tert-butylphenyl)phenyl]-2,8-dioctoxydibenzothiophen-3-yl]benzene-6-id-1-yl]pyridine;iridium (PubChem CID 58915734) has the molecular formula C65H74IrNO2S- and a molecular weight of 1125.60 g/mol. Its IUPAC name is 2-[3-[7-[3,5-bis(4-tert-butylphenyl)phenyl]-2,8-dioctoxydibenzothiophen-3-yl]benzene-6-id-1-yl]pyridine;iridium.
| Compound Name | 2-[3-[7-[3,5-bis(4-tert-butylphenyl)phenyl]-2,8-dioctoxydibenzothiophen-3-yl]benzene-6-id-1-yl]pyridine;iridium |
|---|---|
| PubChem CID | 58915734 |
| Molecular Formula | C65H74IrNO2S- |
| Molecular Weight | 1125.60 g/mol |
| Exact Mass | 1125.51 |
| IUPAC Name | 2-[3-[7-[3,5-bis(4-tert-butylphenyl)phenyl]-2,8-dioctoxydibenzothiophen-3-yl]benzene-6-id-1-yl]pyridine;iridium |
| SMILES | CCCCCCCCOc1cc2c(cc1-c1cc[c-]c(-c3ccccn3)c1)sc1cc(-c3cc(-c4ccc(C(C)(C)C)cc4)cc(-c4ccc(C(C)(C)C)cc4)c3)c(OCCCCCCCC)cc12.[Ir] |
| InChI | InChI=1S/C65H74NO2S.Ir/c1-9-11-13-15-17-21-36-67-60-42-57-58-43-61(68-37-22-18-16-14-12-10-2)56(45-63(58)69-62(57)44-55(60)48-24-23-25-49(38-48)59-26-19-20-35-66-59)52-40-50(46-27-31-53(32-28-46)64(3,4)5)39-51(41-52)47-29-33-54(34-30-47)65(6,7)8;/h19-20,23-24,26-35,38-45H,9-18,21-22,36-37H2,1-8H3;/q-1; |
| InChIKey | NCGXLJJCNWXEEX-UHFFFAOYSA-N |
| XLogP | 19.66 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 70 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1125.60 |
| LogP ≤ 5 | 19.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|