C33H32F3NOS — CID 165168098
8-methyl-1-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[2,3-c]pyridine (PubChem CID 165168098) has the molecular formula C33H32F3NOS and a molecular weight of 547.69 g/mol. Its IUPAC name is 8-methyl-1-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[2,3-c]pyridine.
| Compound Name | 8-methyl-1-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 165168098 |
| Molecular Formula | C33H32F3NOS |
| Molecular Weight | 547.69 g/mol |
| Exact Mass | 547.22 |
| IUPAC Name | 8-methyl-1-(1,1,2,2-tetramethylbenzo[e][1]benzofuran-4-yl)-7-(3,3,3-trifluoro-2,2-dimethylpropyl)-[1]benzothiolo[2,3-c]pyridine |
| SMILES | Cc1c(CC(C)(C)C(F)(F)F)ccc2c1sc1c(-c3cc4ccccc4c4c3OC(C)(C)C4(C)C)nccc12 |
| InChI | InChI=1S/C33H32F3NOS/c1-18-20(17-30(2,3)33(34,35)36)12-13-22-23-14-15-37-26(29(23)39-28(18)22)24-16-19-10-8-9-11-21(19)25-27(24)38-32(6,7)31(25,4)5/h8-16H,17H2,1-7H3 |
| InChIKey | BKZHHDHGDWCVKG-UHFFFAOYSA-N |
| XLogP | 10.16 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.69 |
| LogP ≤ 5 | 10.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |