C21H15F3NOS+ — CID 164722998
3,9,19-trimethyl-14-(trifluoromethyl)-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene (PubChem CID 164722998) has the molecular formula C21H15F3NOS+ and a molecular weight of 386.42 g/mol. Its IUPAC name is 3,9,19-trimethyl-14-(trifluoromethyl)-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene.
| Compound Name | 3,9,19-trimethyl-14-(trifluoromethyl)-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
|---|---|
| PubChem CID | 164722998 |
| Molecular Formula | C21H15F3NOS+ |
| Molecular Weight | 386.42 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 3,9,19-trimethyl-14-(trifluoromethyl)-11-oxa-7-thia-19-azoniapentacyclo[10.7.1.02,10.04,8.016,20]icosa-1(19),2(10),3,5,8,12(20),13,15,17-nonaene |
| SMILES | Cc1c2c(c(C)c3sccc13)Oc1cc(C(F)(F)F)cc3cc[n+](C)c-2c13 |
| InChI | InChI=1S/C21H15F3NOS/c1-10-14-5-7-27-20(14)11(2)19-16(10)18-17-12(4-6-25(18)3)8-13(21(22,23)24)9-15(17)26-19/h4-9H,1-3H3/q+1 |
| InChIKey | CEEJKQBUYDFCLJ-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.42 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|