C15H11FNOS+ — CID 166053196
6-fluoro-3,15-dimethyl-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene (PubChem CID 166053196) has the molecular formula C15H11FNOS+ and a molecular weight of 272.32 g/mol. Its IUPAC name is 6-fluoro-3,15-dimethyl-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene.
| Compound Name | 6-fluoro-3,15-dimethyl-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene |
|---|---|
| PubChem CID | 166053196 |
| Molecular Formula | C15H11FNOS+ |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 6-fluoro-3,15-dimethyl-8-oxa-11-thia-3-azoniatetracyclo[7.6.1.02,7.012,16]hexadeca-1(15),2,4,6,9,12(16),13-heptaene |
| SMILES | Cc1ccc2scc3c2c1-c1c(c(F)cc[n+]1C)O3 |
| InChI | InChI=1S/C15H11FNOS/c1-8-3-4-11-13-10(7-19-11)18-15-9(16)5-6-17(2)14(15)12(8)13/h3-7H,1-2H3/q+1 |
| InChIKey | POPJSTSUTFWDPG-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|