C30H29IrN2O3- — CID 153432988
2-(9,9-dimethyl-3H-xanthen-3-id-2-yl)pyridine;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid (PubChem CID 153432988) has the molecular formula C30H29IrN2O3- and a molecular weight of 657.79 g/mol. Its IUPAC name is 2-(9,9-dimethyl-3H-xanthen-3-id-2-yl)pyridine;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid.
| Compound Name | 2-(9,9-dimethyl-3H-xanthen-3-id-2-yl)pyridine;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 153432988 |
| Molecular Formula | C30H29IrN2O3- |
| Molecular Weight | 657.79 g/mol |
| Exact Mass | 658.18 |
| IUPAC Name | 2-(9,9-dimethyl-3H-xanthen-3-id-2-yl)pyridine;iridium;3,4,5,6-tetramethylpyridine-2-carboxylic acid |
| SMILES | CC1(C)c2ccccc2Oc2c[c-]c(-c3ccccn3)cc21.Cc1nc(C(=O)O)c(C)c(C)c1C.[Ir] |
| InChI | InChI=1S/C20H16NO.C10H13NO2.Ir/c1-20(2)15-7-3-4-9-18(15)22-19-11-10-14(13-16(19)20)17-8-5-6-12-21-17;1-5-6(2)8(4)11-9(7(5)3)10(12)13;/h3-9,11-13H,1-2H3;1-4H3,(H,12,13);/q-1;; |
| InChIKey | DWYUFOMSFNWEBB-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.79 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|