C35H27F3IrN3O3- — CID 153433092
5-cyclopentylpyridine-2-carboxylic acid;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide (PubChem CID 153433092) has the molecular formula C35H27F3IrN3O3- and a molecular weight of 786.83 g/mol. Its IUPAC name is 5-cyclopentylpyridine-2-carboxylic acid;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide.
| Compound Name | 5-cyclopentylpyridine-2-carboxylic acid;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide |
|---|---|
| PubChem CID | 153433092 |
| Molecular Formula | C35H27F3IrN3O3- |
| Molecular Weight | 786.83 g/mol |
| Exact Mass | 787.16 |
| IUPAC Name | 5-cyclopentylpyridine-2-carboxylic acid;iridium;4-pyridin-2-yl-10-[4-(trifluoromethyl)phenyl]-3H-phenoxazin-3-ide |
| SMILES | FC(F)(F)c1ccc(N2c3ccccc3Oc3c(-c4ccccn4)[c-]ccc32)cc1.O=C(O)c1ccc(C2CCCC2)cn1.[Ir] |
| InChI | InChI=1S/C24H14F3N2O.C11H13NO2.Ir/c25-24(26,27)16-11-13-17(14-12-16)29-20-8-1-2-10-22(20)30-23-18(6-5-9-21(23)29)19-7-3-4-15-28-19;13-11(14)10-6-5-9(7-12-10)8-3-1-2-4-8;/h1-5,7-15H;5-8H,1-4H2,(H,13,14);/q-1;; |
| InChIKey | DLVLGHZFRJYZFL-UHFFFAOYSA-N |
| XLogP | 9.58 |
| TPSA | 75.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.83 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|