C32H23IrN2O3- — CID 59621632
4-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene (PubChem CID 59621632) has the molecular formula C32H23IrN2O3- and a molecular weight of 675.76 g/mol. Its IUPAC name is 4-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene.
| Compound Name | 4-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
|---|---|
| PubChem CID | 59621632 |
| Molecular Formula | C32H23IrN2O3- |
| Molecular Weight | 675.76 g/mol |
| Exact Mass | 676.13 |
| IUPAC Name | 4-[(4-ethenylphenyl)methoxy]pyridine-2-carboxylic acid;iridium;6-phenyl-7-azatricyclo[6.3.1.04,12]dodeca-1(12),2,4,6,8,10-hexaene |
| SMILES | C=Cc1ccc(COc2ccnc(C(=O)O)c2)cc1.[Ir].[c-]1ccccc1-c1cc2c3c(cccc3n1)C=C2 |
| InChI | InChI=1S/C17H10N.C15H13NO3.Ir/c1-2-5-12(6-3-1)16-11-14-10-9-13-7-4-8-15(18-16)17(13)14;1-2-11-3-5-12(6-4-11)10-19-13-7-8-16-14(9-13)15(17)18;/h1-5,7-11H;2-9H,1,10H2,(H,17,18);/q-1;; |
| InChIKey | IVROGJPPIGVZCP-UHFFFAOYSA-N |
| XLogP | 7.19 |
| TPSA | 72.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.76 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|