C38H28IrN2OS-2 — CID 153433121
2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)pyridine;iridium;2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)pyridine (PubChem CID 153433121) has the molecular formula C38H28IrN2OS-2 and a molecular weight of 752.94 g/mol. Its IUPAC name is 2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)pyridine;iridium;2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)pyridine.
| Compound Name | 2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)pyridine;iridium;2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)pyridine |
|---|---|
| PubChem CID | 153433121 |
| Molecular Formula | C38H28IrN2OS-2 |
| Molecular Weight | 752.94 g/mol |
| Exact Mass | 753.16 |
| IUPAC Name | 2-(9,9-dimethyl-2H-xanthen-2-id-1-yl)pyridine;iridium;2-(8-methyl-3H-dibenzothiophen-3-id-4-yl)pyridine |
| SMILES | CC1(C)c2ccccc2Oc2cc[c-]c(-c3ccccn3)c21.Cc1ccc2sc3c(-c4ccccn4)[c-]ccc3c2c1.[Ir] |
| InChI | InChI=1S/C20H16NO.C18H12NS.Ir/c1-20(2)15-9-3-4-11-17(15)22-18-12-7-8-14(19(18)20)16-10-5-6-13-21-16;1-12-8-9-17-15(11-12)13-5-4-6-14(18(13)20-17)16-7-2-3-10-19-16;/h3-7,9-13H,1-2H3;2-5,7-11H,1H3;/q2*-1; |
| InChIKey | UAWSSFLSITVYKA-UHFFFAOYSA-N |
| XLogP | 10.20 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.94 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|