C40H29F3IrN2O2-2 — CID 153433195
2-(3H-dibenzofuran-3-id-4-yl)-4-(trifluoromethyl)pyridine;2-(9,9-diethyl-2H-xanthen-2-id-1-yl)pyridine;iridium (PubChem CID 153433195) has the molecular formula C40H29F3IrN2O2-2 and a molecular weight of 818.90 g/mol. Its IUPAC name is 2-(3H-dibenzofuran-3-id-4-yl)-4-(trifluoromethyl)pyridine;2-(9,9-diethyl-2H-xanthen-2-id-1-yl)pyridine;iridium.
| Compound Name | 2-(3H-dibenzofuran-3-id-4-yl)-4-(trifluoromethyl)pyridine;2-(9,9-diethyl-2H-xanthen-2-id-1-yl)pyridine;iridium |
|---|---|
| PubChem CID | 153433195 |
| Molecular Formula | C40H29F3IrN2O2-2 |
| Molecular Weight | 818.90 g/mol |
| Exact Mass | 819.18 |
| IUPAC Name | 2-(3H-dibenzofuran-3-id-4-yl)-4-(trifluoromethyl)pyridine;2-(9,9-diethyl-2H-xanthen-2-id-1-yl)pyridine;iridium |
| SMILES | CCC1(CC)c2ccccc2Oc2cc[c-]c(-c3ccccn3)c21.FC(F)(F)c1ccnc(-c2[c-]ccc3c2oc2ccccc23)c1.[Ir] |
| InChI | InChI=1S/C22H20NO.C18H9F3NO.Ir/c1-3-22(4-2)17-11-5-6-13-19(17)24-20-14-9-10-16(21(20)22)18-12-7-8-15-23-18;19-18(20,21)11-8-9-22-15(10-11)14-6-3-5-13-12-4-1-2-7-16(12)23-17(13)14;/h5-9,11-15H,3-4H2,1-2H3;1-5,7-10H;/q2*-1; |
| InChIKey | UQWGBRGWECEGAG-UHFFFAOYSA-N |
| XLogP | 11.23 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 818.90 |
| LogP ≤ 5 | 11.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|