C16H10F3NO — CID 154715141
2-(trifluoromethyl)-5,6-dihydro-[1]benzofuro[2,3-f]quinoline (PubChem CID 154715141) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is 2-(trifluoromethyl)-5,6-dihydro-[1]benzofuro[2,3-f]quinoline.
| Compound Name | 2-(trifluoromethyl)-5,6-dihydro-[1]benzofuro[2,3-f]quinoline |
|---|---|
| PubChem CID | 154715141 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 2-(trifluoromethyl)-5,6-dihydro-[1]benzofuro[2,3-f]quinoline |
| SMILES | FC(F)(F)c1cnc2c(c1)-c1oc3ccccc3c1CC2 |
| InChI | InChI=1S/C16H10F3NO/c17-16(18,19)9-7-12-13(20-8-9)6-5-11-10-3-1-2-4-14(10)21-15(11)12/h1-4,7-8H,5-6H2 |
| InChIKey | KIAROZMEOJGPPI-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |