C47H44O2 — CID 153433860
4-[2-[3-[2-[3-(1,1-dinaphthalen-1-ylethyl)-4-hydroxyphenyl]propan-2-yl]phenyl]propan-2-yl]-2-methylphenol (PubChem CID 153433860) has the molecular formula C47H44O2 and a molecular weight of 640.87 g/mol. Its IUPAC name is 4-[2-[3-[2-[3-(1,1-dinaphthalen-1-ylethyl)-4-hydroxyphenyl]propan-2-yl]phenyl]propan-2-yl]-2-methylphenol.
| Compound Name | 4-[2-[3-[2-[3-(1,1-dinaphthalen-1-ylethyl)-4-hydroxyphenyl]propan-2-yl]phenyl]propan-2-yl]-2-methylphenol |
|---|---|
| PubChem CID | 153433860 |
| Molecular Formula | C47H44O2 |
| Molecular Weight | 640.87 g/mol |
| Exact Mass | 640.33 |
| IUPAC Name | 4-[2-[3-[2-[3-(1,1-dinaphthalen-1-ylethyl)-4-hydroxyphenyl]propan-2-yl]phenyl]propan-2-yl]-2-methylphenol |
| SMILES | Cc1cc(C(C)(C)c2cccc(C(C)(C)c3ccc(O)c(C(C)(c4cccc5ccccc45)c4cccc5ccccc45)c3)c2)ccc1O |
| InChI | InChI=1S/C47H44O2/c1-31-28-36(24-26-43(31)48)45(2,3)34-18-13-19-35(29-34)46(4,5)37-25-27-44(49)42(30-37)47(6,40-22-11-16-32-14-7-9-20-38(32)40)41-23-12-17-33-15-8-10-21-39(33)41/h7-30,48-49H,1-6H3 |
| InChIKey | ADNUDNBSVDIUKP-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.87 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|