C40H37O2S4+ — CID 153435583
bis[4-(4-acetylphenyl)sulfanylphenyl]-(4-phenylsulfanylcyclohexyl)sulfanium (PubChem CID 153435583) has the molecular formula C40H37O2S4+ and a molecular weight of 678.00 g/mol. Its IUPAC name is bis[4-(4-acetylphenyl)sulfanylphenyl]-(4-phenylsulfanylcyclohexyl)sulfanium.
| Compound Name | bis[4-(4-acetylphenyl)sulfanylphenyl]-(4-phenylsulfanylcyclohexyl)sulfanium |
|---|---|
| PubChem CID | 153435583 |
| Molecular Formula | C40H37O2S4+ |
| Molecular Weight | 678.00 g/mol |
| Exact Mass | 677.17 |
| IUPAC Name | bis[4-(4-acetylphenyl)sulfanylphenyl]-(4-phenylsulfanylcyclohexyl)sulfanium |
| SMILES | CC(=O)c1ccc(Sc2ccc([S+](c3ccc(Sc4ccc(C(C)=O)cc4)cc3)C3CCC(Sc4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C40H37O2S4/c1-28(41)30-8-12-33(13-9-30)44-36-18-24-39(25-19-36)46(38-22-16-35(17-23-38)43-32-6-4-3-5-7-32)40-26-20-37(21-27-40)45-34-14-10-31(11-15-34)29(2)42/h3-15,18-21,24-27,35,38H,16-17,22-23H2,1-2H3/q+1 |
| InChIKey | LTQNPHUQZBKBBE-UHFFFAOYSA-N |
| XLogP | 11.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.00 |
| LogP ≤ 5 | 11.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|