C48H36BF5O3S4 — CID 159763192
(2,3,4,5,6-pentafluorophenyl)boranuide;tris[4-(4-acetylphenyl)sulfanylphenyl]sulfanium (PubChem CID 159763192) has the molecular formula C48H36BF5O3S4 and a molecular weight of 894.88 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl)boranuide;tris[4-(4-acetylphenyl)sulfanylphenyl]sulfanium.
| Compound Name | (2,3,4,5,6-pentafluorophenyl)boranuide;tris[4-(4-acetylphenyl)sulfanylphenyl]sulfanium |
|---|---|
| PubChem CID | 159763192 |
| Molecular Formula | C48H36BF5O3S4 |
| Molecular Weight | 894.88 g/mol |
| Exact Mass | 894.16 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl)boranuide;tris[4-(4-acetylphenyl)sulfanylphenyl]sulfanium |
| SMILES | CC(=O)c1ccc(Sc2ccc([S+](c3ccc(Sc4ccc(C(C)=O)cc4)cc3)c3ccc(Sc4ccc(C(C)=O)cc4)cc3)cc2)cc1.[BH3-]c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C42H33O3S4.C6H3BF5/c1-28(43)31-4-10-34(11-5-31)46-37-16-22-40(23-17-37)49(41-24-18-38(19-25-41)47-35-12-6-32(7-13-35)29(2)44)42-26-20-39(21-27-42)48-36-14-8-33(9-15-36)30(3)45;7-1-2(8)4(10)6(12)5(11)3(1)9/h4-27H,1-3H3;7H3/q+1;-1 |
| InChIKey | NFDVURTXAXRBGJ-UHFFFAOYSA-N |
| XLogP | 12.22 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 894.88 |
| LogP ≤ 5 | 12.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|