C23H26N4O2 — CID 153436045
N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-isocyano-1-pentan-3-ylindole-4-carboxamide (PubChem CID 153436045) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-isocyano-1-pentan-3-ylindole-4-carboxamide.
| Compound Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-isocyano-1-pentan-3-ylindole-4-carboxamide |
|---|---|
| PubChem CID | 153436045 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | N-[(4,6-dimethyl-2-oxo-1H-pyridin-3-yl)methyl]-6-isocyano-1-pentan-3-ylindole-4-carboxamide |
| SMILES | [C-]#[N+]c1cc(C(=O)NCc2c(C)cc(C)[nH]c2=O)c2ccn(C(CC)CC)c2c1 |
| InChI | InChI=1S/C23H26N4O2/c1-6-17(7-2)27-9-8-18-19(11-16(24-5)12-21(18)27)22(28)25-13-20-14(3)10-15(4)26-23(20)29/h8-12,17H,6-7,13H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | PTWPMQJBIADPNJ-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|