C26H26BN3O2 — CID 88889052
CID 88889052 (PubChem CID 88889052) has the molecular formula C26H26BN3O2 and a molecular weight of 423.33 g/mol.
| Compound Name | CID 88889052 |
|---|---|
| PubChem CID | 88889052 |
| Molecular Formula | C26H26BN3O2 |
| Molecular Weight | 423.33 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | — |
| SMILES | [B]c1cc(C(=O)NCc2c(C)cc(Cc3ccccc3)[nH]c2=O)c2ccn(C(C)C)c2c1 |
| InChI | InChI=1S/C26H26BN3O2/c1-16(2)30-10-9-21-22(13-19(27)14-24(21)30)25(31)28-15-23-17(3)11-20(29-26(23)32)12-18-7-5-4-6-8-18/h4-11,13-14,16H,12,15H2,1-3H3,(H,28,31)(H,29,32) |
| InChIKey | GHQWUVJFVLQENU-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 66.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.33 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|