C15H16BNO4 — CID 153438590
(8S)-5-[(E)-2-phenylethenyl]-4,6-dioxa-1-azonia-5-boranuidatricyclo[6.3.0.01,5]undecane-3,7-dione (PubChem CID 153438590) has the molecular formula C15H16BNO4 and a molecular weight of 285.11 g/mol. Its IUPAC name is (8S)-5-[(E)-2-phenylethenyl]-4,6-dioxa-1-azonia-5-boranuidatricyclo[6.3.0.01,5]undecane-3,7-dione.
| Compound Name | (8S)-5-[(E)-2-phenylethenyl]-4,6-dioxa-1-azonia-5-boranuidatricyclo[6.3.0.01,5]undecane-3,7-dione |
|---|---|
| PubChem CID | 153438590 |
| Molecular Formula | C15H16BNO4 |
| Molecular Weight | 285.11 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | (8S)-5-[(E)-2-phenylethenyl]-4,6-dioxa-1-azonia-5-boranuidatricyclo[6.3.0.01,5]undecane-3,7-dione |
| SMILES | O=C1C[N+]23CCC[C@H]2C(=O)O[B-]3(/C=C/c2ccccc2)O1 |
| InChI | InChI=1S/C15H16BNO4/c18-14-11-17-10-4-7-13(17)15(19)21-16(17,20-14)9-8-12-5-2-1-3-6-12/h1-3,5-6,8-9,13H,4,7,10-11H2/b9-8+/t13-,16?,17?/m0/s1 |
| InChIKey | KSXFUMGVGNMZBX-BXRTUHBBSA-N |
| XLogP | 1.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.11 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|