C16H28N2OS — CID 153438655
3-tert-butyl-2-[4-[ethyl(methyl)amino]butyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one (PubChem CID 153438655) has the molecular formula C16H28N2OS and a molecular weight of 296.48 g/mol. Its IUPAC name is 3-tert-butyl-2-[4-[ethyl(methyl)amino]butyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one.
| Compound Name | 3-tert-butyl-2-[4-[ethyl(methyl)amino]butyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one |
|---|---|
| PubChem CID | 153438655 |
| Molecular Formula | C16H28N2OS |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 3-tert-butyl-2-[4-[ethyl(methyl)amino]butyl-methylamino]-4-sulfanylidenecyclobut-2-en-1-one |
| SMILES | CCN(C)CCCCN(C)c1c(C(C)(C)C)c(=S)c1=O |
| InChI | InChI=1S/C16H28N2OS/c1-7-17(5)10-8-9-11-18(6)13-12(16(2,3)4)15(20)14(13)19/h7-11H2,1-6H3 |
| InChIKey | QYQOCOMRKKDRCM-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|