C16H28N2OS2 — CID 153438709
3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethyl-methylamino]cyclobut-3-ene-1,2-dithione (PubChem CID 153438709) has the molecular formula C16H28N2OS2 and a molecular weight of 328.55 g/mol. Its IUPAC name is 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethyl-methylamino]cyclobut-3-ene-1,2-dithione.
| Compound Name | 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethyl-methylamino]cyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 153438709 |
| Molecular Formula | C16H28N2OS2 |
| Molecular Weight | 328.55 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | 3-tert-butyl-4-[2-[2-[ethyl(methyl)amino]ethoxy]ethyl-methylamino]cyclobut-3-ene-1,2-dithione |
| SMILES | CCN(C)CCOCCN(C)c1c(C(C)(C)C)c(=S)c1=S |
| InChI | InChI=1S/C16H28N2OS2/c1-7-17(5)8-10-19-11-9-18(6)13-12(16(2,3)4)14(20)15(13)21/h7-11H2,1-6H3 |
| InChIKey | QLJWQKMLHXCSPP-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.55 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|