C13H22N2OS2 — CID 146475254
3-[2-(2-aminoethoxy)ethyl-methylamino]-4-tert-butylcyclobut-3-ene-1,2-dithione (PubChem CID 146475254) has the molecular formula C13H22N2OS2 and a molecular weight of 286.47 g/mol. Its IUPAC name is 3-[2-(2-aminoethoxy)ethyl-methylamino]-4-tert-butylcyclobut-3-ene-1,2-dithione.
| Compound Name | 3-[2-(2-aminoethoxy)ethyl-methylamino]-4-tert-butylcyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 146475254 |
| Molecular Formula | C13H22N2OS2 |
| Molecular Weight | 286.47 g/mol |
| Exact Mass | 286.12 |
| IUPAC Name | 3-[2-(2-aminoethoxy)ethyl-methylamino]-4-tert-butylcyclobut-3-ene-1,2-dithione |
| SMILES | CN(CCOCCN)c1c(C(C)(C)C)c(=S)c1=S |
| InChI | InChI=1S/C13H22N2OS2/c1-13(2,3)9-10(12(18)11(9)17)15(4)6-8-16-7-5-14/h5-8,14H2,1-4H3 |
| InChIKey | RCFFWXPXKXQQKB-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.47 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|