C16H28N2S2 — CID 153438719
3-tert-butyl-4-[4-[methyl(propyl)amino]butylamino]cyclobut-3-ene-1,2-dithione (PubChem CID 153438719) has the molecular formula C16H28N2S2 and a molecular weight of 312.55 g/mol. Its IUPAC name is 3-tert-butyl-4-[4-[methyl(propyl)amino]butylamino]cyclobut-3-ene-1,2-dithione.
| Compound Name | 3-tert-butyl-4-[4-[methyl(propyl)amino]butylamino]cyclobut-3-ene-1,2-dithione |
|---|---|
| PubChem CID | 153438719 |
| Molecular Formula | C16H28N2S2 |
| Molecular Weight | 312.55 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 3-tert-butyl-4-[4-[methyl(propyl)amino]butylamino]cyclobut-3-ene-1,2-dithione |
| SMILES | CCCN(C)CCCCNc1c(C(C)(C)C)c(=S)c1=S |
| InChI | InChI=1S/C16H28N2S2/c1-6-10-18(5)11-8-7-9-17-13-12(16(2,3)4)14(19)15(13)20/h17H,6-11H2,1-5H3 |
| InChIKey | XAMPACUSWVCRLC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.55 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|