C14H24N2OS2 — CID 146179925
3-[4-[ethyl(methyl)amino]butylamino]-4-sulfanylidene-2-(2-sulfanylpropan-2-yl)cyclobut-2-en-1-one (PubChem CID 146179925) has the molecular formula C14H24N2OS2 and a molecular weight of 300.49 g/mol. Its IUPAC name is 3-[4-[ethyl(methyl)amino]butylamino]-4-sulfanylidene-2-(2-sulfanylpropan-2-yl)cyclobut-2-en-1-one.
| Compound Name | 3-[4-[ethyl(methyl)amino]butylamino]-4-sulfanylidene-2-(2-sulfanylpropan-2-yl)cyclobut-2-en-1-one |
|---|---|
| PubChem CID | 146179925 |
| Molecular Formula | C14H24N2OS2 |
| Molecular Weight | 300.49 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 3-[4-[ethyl(methyl)amino]butylamino]-4-sulfanylidene-2-(2-sulfanylpropan-2-yl)cyclobut-2-en-1-one |
| SMILES | CCN(C)CCCCNc1c(C(C)(C)S)c(=O)c1=S |
| InChI | InChI=1S/C14H24N2OS2/c1-5-16(4)9-7-6-8-15-11-10(14(2,3)19)12(17)13(11)18/h15,19H,5-9H2,1-4H3 |
| InChIKey | QSNFXFRTIBCCLR-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|