C52H70Si6 — CID 153439241
[2-[1,8-bis[2,6-bis(trimethylsilyl)phenyl]pyren-4-yl]-3-trimethylsilylphenyl]-trimethylsilane (PubChem CID 153439241) has the molecular formula C52H70Si6 and a molecular weight of 863.65 g/mol. Its IUPAC name is [2-[1,8-bis[2,6-bis(trimethylsilyl)phenyl]pyren-4-yl]-3-trimethylsilylphenyl]-trimethylsilane.
| Compound Name | [2-[1,8-bis[2,6-bis(trimethylsilyl)phenyl]pyren-4-yl]-3-trimethylsilylphenyl]-trimethylsilane |
|---|---|
| PubChem CID | 153439241 |
| Molecular Formula | C52H70Si6 |
| Molecular Weight | 863.65 g/mol |
| Exact Mass | 862.41 |
| IUPAC Name | [2-[1,8-bis[2,6-bis(trimethylsilyl)phenyl]pyren-4-yl]-3-trimethylsilylphenyl]-trimethylsilane |
| SMILES | C[Si](C)(C)c1cccc([Si](C)(C)C)c1-c1ccc2cc(-c3c([Si](C)(C)C)cccc3[Si](C)(C)C)c3ccc(-c4c([Si](C)(C)C)cccc4[Si](C)(C)C)c4ccc1c2c43 |
| InChI | InChI=1S/C52H70Si6/c1-53(2,3)42-22-19-23-43(54(4,5)6)50(42)38-29-28-35-34-41(52-46(57(13,14)15)26-21-27-47(52)58(16,17)18)40-33-32-39(37-31-30-36(38)48(35)49(37)40)51-44(55(7,8)9)24-20-25-45(51)56(10,11)12/h19-34H,1-18H3 |
| InChIKey | IKCXSTNPTPCLLH-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 863.65 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|