C11H14O2 — CID 15343951
8-methyl-5-propan-2-yl-1-oxaspiro[2.5]octa-5,7-dien-4-one (PubChem CID 15343951) has the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. Its IUPAC name is 8-methyl-5-propan-2-yl-1-oxaspiro[2.5]octa-5,7-dien-4-one.
| Compound Name | 8-methyl-5-propan-2-yl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
|---|---|
| PubChem CID | 15343951 |
| Molecular Formula | C11H14O2 |
| Molecular Weight | 178.23 g/mol |
| Exact Mass | 178.10 |
| IUPAC Name | 8-methyl-5-propan-2-yl-1-oxaspiro[2.5]octa-5,7-dien-4-one |
| SMILES | CC1=CC=C(C(C)C)C(=O)C12CO2 |
| InChI | InChI=1S/C11H14O2/c1-7(2)9-5-4-8(3)11(6-13-11)10(9)12/h4-5,7H,6H2,1-3H3 |
| InChIKey | QKYLGMZNJTXAAD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.23 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|