About manganese;(2-methoxyquinolin-6-yl)methanol
manganese;(2-methoxyquinolin-6-yl)methanol (PubChem CID 153439798) has the molecular formula C11H11MnNO2
and a molecular weight of 244.15 g/mol. Its IUPAC name is manganese;(2-methoxyquinolin-6-yl)methanol.
Molecular Properties
| Compound Name | manganese;(2-methoxyquinolin-6-yl)methanol |
| PubChem CID | 153439798 |
| Molecular Formula | C11H11MnNO2 |
| Molecular Weight | 244.15 g/mol |
| Exact Mass | 244.02 |
| IUPAC Name | manganese;(2-methoxyquinolin-6-yl)methanol |
| SMILES | COc1ccc2cc(CO)ccc2n1.[Mn] |
| InChI | InChI=1S/C11H11NO2.Mn/c1-14-11-5-3-9-6-8(7-13)2-4-10(9)12-11;/h2-6,13H,7H2,1H3; |
| InChIKey | RZYQUGGSMMMDPX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.15 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze manganese;(2-methoxyquinolin-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of manganese;(2-methoxyquinolin-6-yl)methanol?
The IUPAC name of manganese;(2-methoxyquinolin-6-yl)methanol (CID 153439798) is manganese;(2-methoxyquinolin-6-yl)methanol.
What is the SMILES notation for manganese;(2-methoxyquinolin-6-yl)methanol?
The canonical SMILES for manganese;(2-methoxyquinolin-6-yl)methanol is COc1ccc2cc(CO)ccc2n1.[Mn].
What is the InChIKey of manganese;(2-methoxyquinolin-6-yl)methanol?
The InChIKey is RZYQUGGSMMMDPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2.Mn/c1-14-11-5-3-9-6-8(7-13)2-4-10(9)12-11;/h2-6,13H,7H2,1H3;.
What are the key properties of manganese;(2-methoxyquinolin-6-yl)methanol?
manganese;(2-methoxyquinolin-6-yl)methanol has a molecular weight of 244.15 g/mol, XLogP of 1.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for manganese;(2-methoxyquinolin-6-yl)methanol is sourced from PubChem (CID 153439798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).