C18H22N2O3 — CID 177077708
N-[(2-methoxyquinolin-6-yl)methyl]-N-(oxan-4-yl)acetamide (PubChem CID 177077708) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is N-[(2-methoxyquinolin-6-yl)methyl]-N-(oxan-4-yl)acetamide.
| Compound Name | N-[(2-methoxyquinolin-6-yl)methyl]-N-(oxan-4-yl)acetamide |
|---|---|
| PubChem CID | 177077708 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | N-[(2-methoxyquinolin-6-yl)methyl]-N-(oxan-4-yl)acetamide |
| SMILES | COc1ccc2cc(CN(C(C)=O)C3CCOCC3)ccc2n1 |
| InChI | InChI=1S/C18H22N2O3/c1-13(21)20(16-7-9-23-10-8-16)12-14-3-5-17-15(11-14)4-6-18(19-17)22-2/h3-6,11,16H,7-10,12H2,1-2H3 |
| InChIKey | FRKVCUDSZUVCAA-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |